C11H26N4 — CID 152746949
4,7-dimethyl-1,4,7,10-tetrazacyclotridecane (PubChem CID 152746949) has the molecular formula C11H26N4 and a molecular weight of 214.36 g/mol. Its IUPAC name is 4,7-dimethyl-1,4,7,10-tetrazacyclotridecane.
| Compound Name | 4,7-dimethyl-1,4,7,10-tetrazacyclotridecane |
|---|---|
| PubChem CID | 152746949 |
| Molecular Formula | C11H26N4 |
| Molecular Weight | 214.36 g/mol |
| Exact Mass | 214.22 |
| IUPAC Name | 4,7-dimethyl-1,4,7,10-tetrazacyclotridecane |
| SMILES | CN1CCNCCCNCCN(C)CC1 |
| InChI | InChI=1S/C11H26N4/c1-14-8-6-12-4-3-5-13-7-9-15(2)11-10-14/h12-13H,3-11H2,1-2H3 |
| InChIKey | JDFWOJSCUZQPGH-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.36 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |