About 1-ethyl-4-methylpiperazine;morpholine
1-ethyl-4-methylpiperazine;morpholine (PubChem CID 145383471) has the molecular formula C11H25N3O
and a molecular weight of 215.34 g/mol. Its IUPAC name is 1-ethyl-4-methylpiperazine;morpholine.
Molecular Properties
| Compound Name | 1-ethyl-4-methylpiperazine;morpholine |
| PubChem CID | 145383471 |
| Molecular Formula | C11H25N3O |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.20 |
| IUPAC Name | 1-ethyl-4-methylpiperazine;morpholine |
| SMILES | C1COCCN1.CCN1CCN(C)CC1 |
| InChI | InChI=1S/C7H16N2.C4H9NO/c1-3-9-6-4-8(2)5-7-9;1-3-6-4-2-5-1/h3-7H2,1-2H3;5H,1-4H2 |
| InChIKey | YROIBOZICVIBSD-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-ethyl-4-methylpiperazine;morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-methylpiperazine;morpholine?
The IUPAC name of 1-ethyl-4-methylpiperazine;morpholine (CID 145383471) is 1-ethyl-4-methylpiperazine;morpholine.
What is the SMILES notation for 1-ethyl-4-methylpiperazine;morpholine?
The canonical SMILES for 1-ethyl-4-methylpiperazine;morpholine is C1COCCN1.CCN1CCN(C)CC1.
What is the InChIKey of 1-ethyl-4-methylpiperazine;morpholine?
The InChIKey is YROIBOZICVIBSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2.C4H9NO/c1-3-9-6-4-8(2)5-7-9;1-3-6-4-2-5-1/h3-7H2,1-2H3;5H,1-4H2.
What are the key properties of 1-ethyl-4-methylpiperazine;morpholine?
1-ethyl-4-methylpiperazine;morpholine has a molecular weight of 215.34 g/mol, XLogP of -0.14, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-methylpiperazine;morpholine is sourced from PubChem (CID 145383471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).