C18H40N4O3 — CID 174304183
4-(2-ethoxyethyl)-7,13-dimethyl-1,10-dioxa-4,7,13,16-tetrazacyclooctadecane (PubChem CID 174304183) has the molecular formula C18H40N4O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is 4-(2-ethoxyethyl)-7,13-dimethyl-1,10-dioxa-4,7,13,16-tetrazacyclooctadecane.
| Compound Name | 4-(2-ethoxyethyl)-7,13-dimethyl-1,10-dioxa-4,7,13,16-tetrazacyclooctadecane |
|---|---|
| PubChem CID | 174304183 |
| Molecular Formula | C18H40N4O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.31 |
| IUPAC Name | 4-(2-ethoxyethyl)-7,13-dimethyl-1,10-dioxa-4,7,13,16-tetrazacyclooctadecane |
| SMILES | CCOCCN1CCOCCNCCN(C)CCOCCN(C)CC1 |
| InChI | InChI=1S/C18H40N4O3/c1-4-23-17-12-22-9-8-21(3)11-16-25-15-10-20(2)7-5-19-6-14-24-18-13-22/h19H,4-18H2,1-3H3 |
| InChIKey | SUFGFEYCOCOKQA-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 49.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|