C12H26N2O — CID 172575779
morpholine;1-propan-2-ylpiperidine (PubChem CID 172575779) has the molecular formula C12H26N2O and a molecular weight of 214.35 g/mol. Its IUPAC name is morpholine;1-propan-2-ylpiperidine.
| Compound Name | morpholine;1-propan-2-ylpiperidine |
|---|---|
| PubChem CID | 172575779 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | morpholine;1-propan-2-ylpiperidine |
| SMILES | C1COCCN1.CC(C)N1CCCCC1 |
| InChI | InChI=1S/C8H17N.C4H9NO/c1-8(2)9-6-4-3-5-7-9;1-3-6-4-2-5-1/h8H,3-7H2,1-2H3;5H,1-4H2 |
| InChIKey | FCRZDKWAHHMNDJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |