About morpholine;1-propan-2-ylpiperidine
morpholine;1-propan-2-ylpiperidine (PubChem CID 172575779) has the molecular formula C12H26N2O
and a molecular weight of 214.35 g/mol. Its IUPAC name is morpholine;1-propan-2-ylpiperidine.
Molecular Properties
| Compound Name | morpholine;1-propan-2-ylpiperidine |
| PubChem CID | 172575779 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | morpholine;1-propan-2-ylpiperidine |
| SMILES | C1COCCN1.CC(C)N1CCCCC1 |
| InChI | InChI=1S/C8H17N.C4H9NO/c1-8(2)9-6-4-3-5-7-9;1-3-6-4-2-5-1/h8H,3-7H2,1-2H3;5H,1-4H2 |
| InChIKey | FCRZDKWAHHMNDJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze morpholine;1-propan-2-ylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholine;1-propan-2-ylpiperidine?
The IUPAC name of morpholine;1-propan-2-ylpiperidine (CID 172575779) is morpholine;1-propan-2-ylpiperidine.
What is the SMILES notation for morpholine;1-propan-2-ylpiperidine?
The canonical SMILES for morpholine;1-propan-2-ylpiperidine is C1COCCN1.CC(C)N1CCCCC1.
What is the InChIKey of morpholine;1-propan-2-ylpiperidine?
The InChIKey is FCRZDKWAHHMNDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N.C4H9NO/c1-8(2)9-6-4-3-5-7-9;1-3-6-4-2-5-1/h8H,3-7H2,1-2H3;5H,1-4H2.
What are the key properties of morpholine;1-propan-2-ylpiperidine?
morpholine;1-propan-2-ylpiperidine has a molecular weight of 214.35 g/mol, XLogP of 1.49, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for morpholine;1-propan-2-ylpiperidine is sourced from PubChem (CID 172575779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).