About ethene;1-propan-2-ylpiperidine
ethene;1-propan-2-ylpiperidine (PubChem CID 177325228) has the molecular formula C10H21N
and a molecular weight of 155.28 g/mol. Its IUPAC name is ethene;1-propan-2-ylpiperidine.
Molecular Properties
| Compound Name | ethene;1-propan-2-ylpiperidine |
| PubChem CID | 177325228 |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.28 g/mol |
| Exact Mass | 155.17 |
| IUPAC Name | ethene;1-propan-2-ylpiperidine |
| SMILES | C=C.CC(C)N1CCCCC1 |
| InChI | InChI=1S/C8H17N.C2H4/c1-8(2)9-6-4-3-5-7-9;1-2/h8H,3-7H2,1-2H3;1-2H2 |
| InChIKey | KEOIBAMZTOCBTL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.28 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;1-propan-2-ylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;1-propan-2-ylpiperidine?
The IUPAC name of ethene;1-propan-2-ylpiperidine (CID 177325228) is ethene;1-propan-2-ylpiperidine.
What is the SMILES notation for ethene;1-propan-2-ylpiperidine?
The canonical SMILES for ethene;1-propan-2-ylpiperidine is C=C.CC(C)N1CCCCC1.
What is the InChIKey of ethene;1-propan-2-ylpiperidine?
The InChIKey is KEOIBAMZTOCBTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N.C2H4/c1-8(2)9-6-4-3-5-7-9;1-2/h8H,3-7H2,1-2H3;1-2H2.
What are the key properties of ethene;1-propan-2-ylpiperidine?
ethene;1-propan-2-ylpiperidine has a molecular weight of 155.28 g/mol, XLogP of 2.68, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;1-propan-2-ylpiperidine is sourced from PubChem (CID 177325228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).