C10H24N2 — CID 177158830
N,N-dimethylmethanamine;1-propan-2-ylpyrrolidine (PubChem CID 177158830) has the molecular formula C10H24N2 and a molecular weight of 172.32 g/mol. Its IUPAC name is N,N-dimethylmethanamine;1-propan-2-ylpyrrolidine.
| Compound Name | N,N-dimethylmethanamine;1-propan-2-ylpyrrolidine |
|---|---|
| PubChem CID | 177158830 |
| Molecular Formula | C10H24N2 |
| Molecular Weight | 172.32 g/mol |
| Exact Mass | 172.19 |
| IUPAC Name | N,N-dimethylmethanamine;1-propan-2-ylpyrrolidine |
| SMILES | CC(C)N1CCCC1.CN(C)C |
| InChI | InChI=1S/C7H15N.C3H9N/c1-7(2)8-5-3-4-6-8;1-4(2)3/h7H,3-6H2,1-2H3;1-3H3 |
| InChIKey | KRSRXPHZKRVLTL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |