C12H28N2O — CID 162750414
N,N-dimethylformamide;ethane;1-propan-2-ylpyrrolidine (PubChem CID 162750414) has the molecular formula C12H28N2O and a molecular weight of 216.37 g/mol. Its IUPAC name is N,N-dimethylformamide;ethane;1-propan-2-ylpyrrolidine.
| Compound Name | N,N-dimethylformamide;ethane;1-propan-2-ylpyrrolidine |
|---|---|
| PubChem CID | 162750414 |
| Molecular Formula | C12H28N2O |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.22 |
| IUPAC Name | N,N-dimethylformamide;ethane;1-propan-2-ylpyrrolidine |
| SMILES | CC.CC(C)N1CCCC1.CN(C)C=O |
| InChI | InChI=1S/C7H15N.C3H7NO.C2H6/c1-7(2)8-5-3-4-6-8;1-4(2)3-5;1-2/h7H,3-6H2,1-2H3;3H,1-2H3;1-2H3 |
| InChIKey | YQWULFRQQZBVPK-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|