About formic acid;1-propan-2-ylpyrrolidine
formic acid;1-propan-2-ylpyrrolidine (PubChem CID 162750581) has the molecular formula C8H17NO2
and a molecular weight of 159.23 g/mol. Its IUPAC name is formic acid;1-propan-2-ylpyrrolidine.
Molecular Properties
| Compound Name | formic acid;1-propan-2-ylpyrrolidine |
| PubChem CID | 162750581 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | formic acid;1-propan-2-ylpyrrolidine |
| SMILES | CC(C)N1CCCC1.O=CO |
| InChI | InChI=1S/C7H15N.CH2O2/c1-7(2)8-5-3-4-6-8;2-1-3/h7H,3-6H2,1-2H3;1H,(H,2,3) |
| InChIKey | CGVRLZKIMTUYPC-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formic acid;1-propan-2-ylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;1-propan-2-ylpyrrolidine?
The IUPAC name of formic acid;1-propan-2-ylpyrrolidine (CID 162750581) is formic acid;1-propan-2-ylpyrrolidine.
What is the SMILES notation for formic acid;1-propan-2-ylpyrrolidine?
The canonical SMILES for formic acid;1-propan-2-ylpyrrolidine is CC(C)N1CCCC1.O=CO.
What is the InChIKey of formic acid;1-propan-2-ylpyrrolidine?
The InChIKey is CGVRLZKIMTUYPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N.CH2O2/c1-7(2)8-5-3-4-6-8;2-1-3/h7H,3-6H2,1-2H3;1H,(H,2,3).
What are the key properties of formic acid;1-propan-2-ylpyrrolidine?
formic acid;1-propan-2-ylpyrrolidine has a molecular weight of 159.23 g/mol, XLogP of 1.19, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;1-propan-2-ylpyrrolidine is sourced from PubChem (CID 162750581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).