About propan-2-one;1-propan-2-ylpyrrolidine
propan-2-one;1-propan-2-ylpyrrolidine (PubChem CID 160872903) has the molecular formula C10H21NO
and a molecular weight of 171.28 g/mol. Its IUPAC name is propan-2-one;1-propan-2-ylpyrrolidine.
Molecular Properties
| Compound Name | propan-2-one;1-propan-2-ylpyrrolidine |
| PubChem CID | 160872903 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | propan-2-one;1-propan-2-ylpyrrolidine |
| SMILES | CC(C)=O.CC(C)N1CCCC1 |
| InChI | InChI=1S/C7H15N.C3H6O/c1-7(2)8-5-3-4-6-8;1-3(2)4/h7H,3-6H2,1-2H3;1-2H3 |
| InChIKey | SLZLCFCVHDLGFL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propan-2-one;1-propan-2-ylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-one;1-propan-2-ylpyrrolidine?
The IUPAC name of propan-2-one;1-propan-2-ylpyrrolidine (CID 160872903) is propan-2-one;1-propan-2-ylpyrrolidine.
What is the SMILES notation for propan-2-one;1-propan-2-ylpyrrolidine?
The canonical SMILES for propan-2-one;1-propan-2-ylpyrrolidine is CC(C)=O.CC(C)N1CCCC1.
What is the InChIKey of propan-2-one;1-propan-2-ylpyrrolidine?
The InChIKey is SLZLCFCVHDLGFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N.C3H6O/c1-7(2)8-5-3-4-6-8;1-3(2)4/h7H,3-6H2,1-2H3;1-2H3.
What are the key properties of propan-2-one;1-propan-2-ylpyrrolidine?
propan-2-one;1-propan-2-ylpyrrolidine has a molecular weight of 171.28 g/mol, XLogP of 2.09, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-one;1-propan-2-ylpyrrolidine is sourced from PubChem (CID 160872903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).