About fluoroform;1-propan-2-ylpyrrolidine
fluoroform;1-propan-2-ylpyrrolidine (PubChem CID 169177583) has the molecular formula C8H16F3N
and a molecular weight of 183.22 g/mol. Its IUPAC name is fluoroform;1-propan-2-ylpyrrolidine.
Molecular Properties
| Compound Name | fluoroform;1-propan-2-ylpyrrolidine |
| PubChem CID | 169177583 |
| Molecular Formula | C8H16F3N |
| Molecular Weight | 183.22 g/mol |
| Exact Mass | 183.12 |
| IUPAC Name | fluoroform;1-propan-2-ylpyrrolidine |
| SMILES | CC(C)N1CCCC1.FC(F)F |
| InChI | InChI=1S/C7H15N.CHF3/c1-7(2)8-5-3-4-6-8;2-1(3)4/h7H,3-6H2,1-2H3;1H |
| InChIKey | GHUADBHNZBSSMK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.22 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze fluoroform;1-propan-2-ylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoroform;1-propan-2-ylpyrrolidine?
The IUPAC name of fluoroform;1-propan-2-ylpyrrolidine (CID 169177583) is fluoroform;1-propan-2-ylpyrrolidine.
What is the SMILES notation for fluoroform;1-propan-2-ylpyrrolidine?
The canonical SMILES for fluoroform;1-propan-2-ylpyrrolidine is CC(C)N1CCCC1.FC(F)F.
What is the InChIKey of fluoroform;1-propan-2-ylpyrrolidine?
The InChIKey is GHUADBHNZBSSMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N.CHF3/c1-7(2)8-5-3-4-6-8;2-1(3)4/h7H,3-6H2,1-2H3;1H.
What are the key properties of fluoroform;1-propan-2-ylpyrrolidine?
fluoroform;1-propan-2-ylpyrrolidine has a molecular weight of 183.22 g/mol, XLogP of 2.67, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for fluoroform;1-propan-2-ylpyrrolidine is sourced from PubChem (CID 169177583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).