About methoxymethane;1-propan-2-ylazepane
methoxymethane;1-propan-2-ylazepane (PubChem CID 178173420) has the molecular formula C11H25NO
and a molecular weight of 187.33 g/mol. Its IUPAC name is methoxymethane;1-propan-2-ylazepane.
Molecular Properties
| Compound Name | methoxymethane;1-propan-2-ylazepane |
| PubChem CID | 178173420 |
| Molecular Formula | C11H25NO |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.19 |
| IUPAC Name | methoxymethane;1-propan-2-ylazepane |
| SMILES | CC(C)N1CCCCCC1.COC |
| InChI | InChI=1S/C9H19N.C2H6O/c1-9(2)10-7-5-3-4-6-8-10;1-3-2/h9H,3-8H2,1-2H3;1-2H3 |
| InChIKey | NRDXKMPAEQQZIV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methoxymethane;1-propan-2-ylazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxymethane;1-propan-2-ylazepane?
The IUPAC name of methoxymethane;1-propan-2-ylazepane (CID 178173420) is methoxymethane;1-propan-2-ylazepane.
What is the SMILES notation for methoxymethane;1-propan-2-ylazepane?
The canonical SMILES for methoxymethane;1-propan-2-ylazepane is CC(C)N1CCCCCC1.COC.
What is the InChIKey of methoxymethane;1-propan-2-ylazepane?
The InChIKey is NRDXKMPAEQQZIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N.C2H6O/c1-9(2)10-7-5-3-4-6-8-10;1-3-2/h9H,3-8H2,1-2H3;1-2H3.
What are the key properties of methoxymethane;1-propan-2-ylazepane?
methoxymethane;1-propan-2-ylazepane has a molecular weight of 187.33 g/mol, XLogP of 2.53, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methoxymethane;1-propan-2-ylazepane is sourced from PubChem (CID 178173420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).