About ethane;1-methylazepane;1-propan-2-ylpiperidine
ethane;1-methylazepane;1-propan-2-ylpiperidine (PubChem CID 170601993) has the molecular formula C17H38N2
and a molecular weight of 270.50 g/mol. Its IUPAC name is ethane;1-methylazepane;1-propan-2-ylpiperidine.
Molecular Properties
| Compound Name | ethane;1-methylazepane;1-propan-2-ylpiperidine |
| PubChem CID | 170601993 |
| Molecular Formula | C17H38N2 |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 270.30 |
| IUPAC Name | ethane;1-methylazepane;1-propan-2-ylpiperidine |
| SMILES | CC.CC(C)N1CCCCC1.CN1CCCCCC1 |
| InChI | InChI=1S/C8H17N.C7H15N.C2H6/c1-8(2)9-6-4-3-5-7-9;1-8-6-4-2-3-5-7-8;1-2/h8H,3-7H2,1-2H3;2-7H2,1H3;1-2H3 |
| InChIKey | PUAWPPVSBJAFFC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;1-methylazepane;1-propan-2-ylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methylazepane;1-propan-2-ylpiperidine?
The IUPAC name of ethane;1-methylazepane;1-propan-2-ylpiperidine (CID 170601993) is ethane;1-methylazepane;1-propan-2-ylpiperidine.
What is the SMILES notation for ethane;1-methylazepane;1-propan-2-ylpiperidine?
The canonical SMILES for ethane;1-methylazepane;1-propan-2-ylpiperidine is CC.CC(C)N1CCCCC1.CN1CCCCCC1.
What is the InChIKey of ethane;1-methylazepane;1-propan-2-ylpiperidine?
The InChIKey is PUAWPPVSBJAFFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N.C7H15N.C2H6/c1-8(2)9-6-4-3-5-7-9;1-8-6-4-2-3-5-7-8;1-2/h8H,3-7H2,1-2H3;2-7H2,1H3;1-2H3.
What are the key properties of ethane;1-methylazepane;1-propan-2-ylpiperidine?
ethane;1-methylazepane;1-propan-2-ylpiperidine has a molecular weight of 270.50 g/mol, XLogP of 4.40, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methylazepane;1-propan-2-ylpiperidine is sourced from PubChem (CID 170601993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).