About ethane;1-ethyl-4-methylpiperazine;1-propan-2-ylpiperidine
ethane;1-ethyl-4-methylpiperazine;1-propan-2-ylpiperidine (PubChem CID 176978736) has the molecular formula C19H45N3
and a molecular weight of 315.59 g/mol. Its IUPAC name is ethane;1-ethyl-4-methylpiperazine;1-propan-2-ylpiperidine.
Molecular Properties
| Compound Name | ethane;1-ethyl-4-methylpiperazine;1-propan-2-ylpiperidine |
| PubChem CID | 176978736 |
| Molecular Formula | C19H45N3 |
| Molecular Weight | 315.59 g/mol |
| Exact Mass | 315.36 |
| IUPAC Name | ethane;1-ethyl-4-methylpiperazine;1-propan-2-ylpiperidine |
| SMILES | CC.CC.CC(C)N1CCCCC1.CCN1CCN(C)CC1 |
| InChI | InChI=1S/C8H17N.C7H16N2.2C2H6/c1-8(2)9-6-4-3-5-7-9;1-3-9-6-4-8(2)5-7-9;2*1-2/h8H,3-7H2,1-2H3;3-7H2,1-2H3;2*1-2H3 |
| InChIKey | LMVDJHKALHJPRD-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.59 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;1-ethyl-4-methylpiperazine;1-propan-2-ylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethyl-4-methylpiperazine;1-propan-2-ylpiperidine?
The IUPAC name of ethane;1-ethyl-4-methylpiperazine;1-propan-2-ylpiperidine (CID 176978736) is ethane;1-ethyl-4-methylpiperazine;1-propan-2-ylpiperidine.
What is the SMILES notation for ethane;1-ethyl-4-methylpiperazine;1-propan-2-ylpiperidine?
The canonical SMILES for ethane;1-ethyl-4-methylpiperazine;1-propan-2-ylpiperidine is CC.CC.CC(C)N1CCCCC1.CCN1CCN(C)CC1.
What is the InChIKey of ethane;1-ethyl-4-methylpiperazine;1-propan-2-ylpiperidine?
The InChIKey is LMVDJHKALHJPRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N.C7H16N2.2C2H6/c1-8(2)9-6-4-3-5-7-9;1-3-9-6-4-8(2)5-7-9;2*1-2/h8H,3-7H2,1-2H3;3-7H2,1-2H3;2*1-2H3.
What are the key properties of ethane;1-ethyl-4-methylpiperazine;1-propan-2-ylpiperidine?
ethane;1-ethyl-4-methylpiperazine;1-propan-2-ylpiperidine has a molecular weight of 315.59 g/mol, XLogP of 4.19, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethyl-4-methylpiperazine;1-propan-2-ylpiperidine is sourced from PubChem (CID 176978736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).