About ethane;1-propan-2-ylpyrrolidine
ethane;1-propan-2-ylpyrrolidine (PubChem CID 167557798) has the molecular formula C15H39N
and a molecular weight of 233.48 g/mol. Its IUPAC name is ethane;1-propan-2-ylpyrrolidine.
Molecular Properties
| Compound Name | ethane;1-propan-2-ylpyrrolidine |
| PubChem CID | 167557798 |
| Molecular Formula | C15H39N |
| Molecular Weight | 233.48 g/mol |
| Exact Mass | 233.31 |
| IUPAC Name | ethane;1-propan-2-ylpyrrolidine |
| SMILES | CC.CC.CC.CC.CC(C)N1CCCC1 |
| InChI | InChI=1S/C7H15N.4C2H6/c1-7(2)8-5-3-4-6-8;4*1-2/h7H,3-6H2,1-2H3;4*1-2H3 |
| InChIKey | DFXSZBJDMUNEQQ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 233.48 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;1-propan-2-ylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-propan-2-ylpyrrolidine?
The IUPAC name of ethane;1-propan-2-ylpyrrolidine (CID 167557798) is ethane;1-propan-2-ylpyrrolidine.
What is the SMILES notation for ethane;1-propan-2-ylpyrrolidine?
The canonical SMILES for ethane;1-propan-2-ylpyrrolidine is CC.CC.CC.CC.CC(C)N1CCCC1.
What is the InChIKey of ethane;1-propan-2-ylpyrrolidine?
The InChIKey is DFXSZBJDMUNEQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N.4C2H6/c1-7(2)8-5-3-4-6-8;4*1-2/h7H,3-6H2,1-2H3;4*1-2H3.
What are the key properties of ethane;1-propan-2-ylpyrrolidine?
ethane;1-propan-2-ylpyrrolidine has a molecular weight of 233.48 g/mol, XLogP of 5.60, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-propan-2-ylpyrrolidine is sourced from PubChem (CID 167557798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).