About propan-2-amine;1-propan-2-ylpiperidine
propan-2-amine;1-propan-2-ylpiperidine (PubChem CID 142245197) has the molecular formula C11H26N2
and a molecular weight of 186.34 g/mol. Its IUPAC name is propan-2-amine;1-propan-2-ylpiperidine.
Molecular Properties
| Compound Name | propan-2-amine;1-propan-2-ylpiperidine |
| PubChem CID | 142245197 |
| Molecular Formula | C11H26N2 |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.21 |
| IUPAC Name | propan-2-amine;1-propan-2-ylpiperidine |
| SMILES | CC(C)N.CC(C)N1CCCCC1 |
| InChI | InChI=1S/C8H17N.C3H9N/c1-8(2)9-6-4-3-5-7-9;1-3(2)4/h8H,3-7H2,1-2H3;3H,4H2,1-2H3 |
| InChIKey | BBZAZUORVPLGSQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propan-2-amine;1-propan-2-ylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-amine;1-propan-2-ylpiperidine?
The IUPAC name of propan-2-amine;1-propan-2-ylpiperidine (CID 142245197) is propan-2-amine;1-propan-2-ylpiperidine.
What is the SMILES notation for propan-2-amine;1-propan-2-ylpiperidine?
The canonical SMILES for propan-2-amine;1-propan-2-ylpiperidine is CC(C)N.CC(C)N1CCCCC1.
What is the InChIKey of propan-2-amine;1-propan-2-ylpiperidine?
The InChIKey is BBZAZUORVPLGSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N.C3H9N/c1-8(2)9-6-4-3-5-7-9;1-3(2)4/h8H,3-7H2,1-2H3;3H,4H2,1-2H3.
What are the key properties of propan-2-amine;1-propan-2-ylpiperidine?
propan-2-amine;1-propan-2-ylpiperidine has a molecular weight of 186.34 g/mol, XLogP of 2.23, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-amine;1-propan-2-ylpiperidine is sourced from PubChem (CID 142245197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).