About 1-methyl-4-propan-2-ylpiperazine;1-propan-2-ylazepane
1-methyl-4-propan-2-ylpiperazine;1-propan-2-ylazepane (PubChem CID 170616932) has the molecular formula C17H37N3
and a molecular weight of 283.50 g/mol. Its IUPAC name is 1-methyl-4-propan-2-ylpiperazine;1-propan-2-ylazepane.
Molecular Properties
| Compound Name | 1-methyl-4-propan-2-ylpiperazine;1-propan-2-ylazepane |
| PubChem CID | 170616932 |
| Molecular Formula | C17H37N3 |
| Molecular Weight | 283.50 g/mol |
| Exact Mass | 283.30 |
| IUPAC Name | 1-methyl-4-propan-2-ylpiperazine;1-propan-2-ylazepane |
| SMILES | CC(C)N1CCCCCC1.CC(C)N1CCN(C)CC1 |
| InChI | InChI=1S/C9H19N.C8H18N2/c1-9(2)10-7-5-3-4-6-8-10;1-8(2)10-6-4-9(3)5-7-10/h9H,3-8H2,1-2H3;8H,4-7H2,1-3H3 |
| InChIKey | ZGPSHOWIAXKDQZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.50 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-4-propan-2-ylpiperazine;1-propan-2-ylazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-propan-2-ylpiperazine;1-propan-2-ylazepane?
The IUPAC name of 1-methyl-4-propan-2-ylpiperazine;1-propan-2-ylazepane (CID 170616932) is 1-methyl-4-propan-2-ylpiperazine;1-propan-2-ylazepane.
What is the SMILES notation for 1-methyl-4-propan-2-ylpiperazine;1-propan-2-ylazepane?
The canonical SMILES for 1-methyl-4-propan-2-ylpiperazine;1-propan-2-ylazepane is CC(C)N1CCCCCC1.CC(C)N1CCN(C)CC1.
What is the InChIKey of 1-methyl-4-propan-2-ylpiperazine;1-propan-2-ylazepane?
The InChIKey is ZGPSHOWIAXKDQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N.C8H18N2/c1-9(2)10-7-5-3-4-6-8-10;1-8(2)10-6-4-9(3)5-7-10/h9H,3-8H2,1-2H3;8H,4-7H2,1-3H3.
What are the key properties of 1-methyl-4-propan-2-ylpiperazine;1-propan-2-ylazepane?
1-methyl-4-propan-2-ylpiperazine;1-propan-2-ylazepane has a molecular weight of 283.50 g/mol, XLogP of 2.91, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-propan-2-ylpiperazine;1-propan-2-ylazepane is sourced from PubChem (CID 170616932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).