C8H18N2 — CID 7471963
1-methyl-4-propan-2-ylpiperazine (PubChem CID 7471963) has the molecular formula C8H18N2 and a molecular weight of 142.25 g/mol. Its IUPAC name is 1-methyl-4-propan-2-ylpiperazine.
| Compound Name | 1-methyl-4-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 7471963 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | 1-methyl-4-propan-2-ylpiperazine |
| SMILES | CC(C)N1CCN(C)CC1 |
| InChI | InChI=1S/C8H18N2/c1-8(2)10-6-4-9(3)5-7-10/h8H,4-7H2,1-3H3 |
| InChIKey | ODIQTOYGORNLPE-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |