C23H52N6 — CID 158395030
1-tert-butyl-4,7-dimethyl-1,4,7-triazonane;1,4-dimethyl-7-propan-2-yl-1,4,7-triazonane (PubChem CID 158395030) has the molecular formula C23H52N6 and a molecular weight of 412.71 g/mol. Its IUPAC name is 1-tert-butyl-4,7-dimethyl-1,4,7-triazonane;1,4-dimethyl-7-propan-2-yl-1,4,7-triazonane.
| Compound Name | 1-tert-butyl-4,7-dimethyl-1,4,7-triazonane;1,4-dimethyl-7-propan-2-yl-1,4,7-triazonane |
|---|---|
| PubChem CID | 158395030 |
| Molecular Formula | C23H52N6 |
| Molecular Weight | 412.71 g/mol |
| Exact Mass | 412.43 |
| IUPAC Name | 1-tert-butyl-4,7-dimethyl-1,4,7-triazonane;1,4-dimethyl-7-propan-2-yl-1,4,7-triazonane |
| SMILES | CC(C)N1CCN(C)CCN(C)CC1.CN1CCN(C)CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C12H27N3.C11H25N3/c1-12(2,3)15-10-8-13(4)6-7-14(5)9-11-15;1-11(2)14-9-7-12(3)5-6-13(4)8-10-14/h6-11H2,1-5H3;11H,5-10H2,1-4H3 |
| InChIKey | GXLDWSGJYCGXLF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 19.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.71 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |