C16H38N4Zn — CID 162271168
1-tert-butyl-4,7,10-trimethyl-1,4,7,10-tetrazacyclododecane;methane;zinc (PubChem CID 162271168) has the molecular formula C16H38N4Zn and a molecular weight of 351.90 g/mol. Its IUPAC name is 1-tert-butyl-4,7,10-trimethyl-1,4,7,10-tetrazacyclododecane;methane;zinc.
| Compound Name | 1-tert-butyl-4,7,10-trimethyl-1,4,7,10-tetrazacyclododecane;methane;zinc |
|---|---|
| PubChem CID | 162271168 |
| Molecular Formula | C16H38N4Zn |
| Molecular Weight | 351.90 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | 1-tert-butyl-4,7,10-trimethyl-1,4,7,10-tetrazacyclododecane;methane;zinc |
| SMILES | C.CN1CCN(C)CCN(C(C)(C)C)CCN(C)CC1.[Zn] |
| InChI | InChI=1S/C15H34N4.CH4.Zn/c1-15(2,3)19-13-11-17(5)9-7-16(4)8-10-18(6)12-14-19;;/h7-14H2,1-6H3;1H4; |
| InChIKey | NXBCQNQMSSDVCP-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.90 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|