C26H56N4O — CID 157270913
1-tert-butyl-4-methylpiperazine;4-tert-butylmorpholine;1-tert-butylpiperidine (PubChem CID 157270913) has the molecular formula C26H56N4O and a molecular weight of 440.76 g/mol. Its IUPAC name is 1-tert-butyl-4-methylpiperazine;4-tert-butylmorpholine;1-tert-butylpiperidine.
| Compound Name | 1-tert-butyl-4-methylpiperazine;4-tert-butylmorpholine;1-tert-butylpiperidine |
|---|---|
| PubChem CID | 157270913 |
| Molecular Formula | C26H56N4O |
| Molecular Weight | 440.76 g/mol |
| Exact Mass | 440.45 |
| IUPAC Name | 1-tert-butyl-4-methylpiperazine;4-tert-butylmorpholine;1-tert-butylpiperidine |
| SMILES | CC(C)(C)N1CCCCC1.CC(C)(C)N1CCOCC1.CN1CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C9H20N2.C9H19N.C8H17NO/c1-9(2,3)11-7-5-10(4)6-8-11;1-9(2,3)10-7-5-4-6-8-10;1-8(2,3)9-4-6-10-7-5-9/h5-8H2,1-4H3;4-8H2,1-3H3;4-7H2,1-3H3 |
| InChIKey | AYNIRABEKFNWET-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 22.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.76 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |