C19H40N2 — CID 158450868
1-tert-butylazepane;1-tert-butylpiperidine (PubChem CID 158450868) has the molecular formula C19H40N2 and a molecular weight of 296.54 g/mol. Its IUPAC name is 1-tert-butylazepane;1-tert-butylpiperidine.
| Compound Name | 1-tert-butylazepane;1-tert-butylpiperidine |
|---|---|
| PubChem CID | 158450868 |
| Molecular Formula | C19H40N2 |
| Molecular Weight | 296.54 g/mol |
| Exact Mass | 296.32 |
| IUPAC Name | 1-tert-butylazepane;1-tert-butylpiperidine |
| SMILES | CC(C)(C)N1CCCCC1.CC(C)(C)N1CCCCCC1 |
| InChI | InChI=1S/C10H21N.C9H19N/c1-10(2,3)11-8-6-4-5-7-9-11;1-9(2,3)10-7-5-4-6-8-10/h4-9H2,1-3H3;4-8H2,1-3H3 |
| InChIKey | HDYRXNRKZCWBHA-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.54 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |