C17H36N2 — CID 90712737
1,6-ditert-butyl-1,6-diazacycloundecane (PubChem CID 90712737) has the molecular formula C17H36N2 and a molecular weight of 268.49 g/mol. Its IUPAC name is 1,6-ditert-butyl-1,6-diazacycloundecane.
| Compound Name | 1,6-ditert-butyl-1,6-diazacycloundecane |
|---|---|
| PubChem CID | 90712737 |
| Molecular Formula | C17H36N2 |
| Molecular Weight | 268.49 g/mol |
| Exact Mass | 268.29 |
| IUPAC Name | 1,6-ditert-butyl-1,6-diazacycloundecane |
| SMILES | CC(C)(C)N1CCCCCN(C(C)(C)C)CCCC1 |
| InChI | InChI=1S/C17H36N2/c1-16(2,3)18-12-8-7-9-13-19(17(4,5)6)15-11-10-14-18/h7-15H2,1-6H3 |
| InChIKey | JAQVREBATHPCBK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |