C22H49N3O — CID 159248645
1-tert-butyl-4-methylpiperazine;1-tert-butylpyrrolidine;2-methoxy-2-methylpropane (PubChem CID 159248645) has the molecular formula C22H49N3O and a molecular weight of 371.65 g/mol. Its IUPAC name is 1-tert-butyl-4-methylpiperazine;1-tert-butylpyrrolidine;2-methoxy-2-methylpropane.
| Compound Name | 1-tert-butyl-4-methylpiperazine;1-tert-butylpyrrolidine;2-methoxy-2-methylpropane |
|---|---|
| PubChem CID | 159248645 |
| Molecular Formula | C22H49N3O |
| Molecular Weight | 371.65 g/mol |
| Exact Mass | 371.39 |
| IUPAC Name | 1-tert-butyl-4-methylpiperazine;1-tert-butylpyrrolidine;2-methoxy-2-methylpropane |
| SMILES | CC(C)(C)N1CCCC1.CN1CCN(C(C)(C)C)CC1.COC(C)(C)C |
| InChI | InChI=1S/C9H20N2.C8H17N.C5H12O/c1-9(2,3)11-7-5-10(4)6-8-11;1-8(2,3)9-6-4-5-7-9;1-5(2,3)6-4/h5-8H2,1-4H3;4-7H2,1-3H3;1-4H3 |
| InChIKey | KUZQZAIPFSHXTE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.65 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |