C18H39N3 — CID 156749865
1-tert-butyl-4-methylpiperazine;1-tert-butylpiperidine (PubChem CID 156749865) has the molecular formula C18H39N3 and a molecular weight of 297.53 g/mol. Its IUPAC name is 1-tert-butyl-4-methylpiperazine;1-tert-butylpiperidine.
| Compound Name | 1-tert-butyl-4-methylpiperazine;1-tert-butylpiperidine |
|---|---|
| PubChem CID | 156749865 |
| Molecular Formula | C18H39N3 |
| Molecular Weight | 297.53 g/mol |
| Exact Mass | 297.31 |
| IUPAC Name | 1-tert-butyl-4-methylpiperazine;1-tert-butylpiperidine |
| SMILES | CC(C)(C)N1CCCCC1.CN1CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C9H20N2.C9H19N/c1-9(2,3)11-7-5-10(4)6-8-11;1-9(2,3)10-7-5-4-6-8-10/h5-8H2,1-4H3;4-8H2,1-3H3 |
| InChIKey | LJMNHHSLVGOUGS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.53 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |