C22H50N6 — CID 157390684
1,4-dimethyl-7-propan-2-yl-1,4,7-triazonane (PubChem CID 157390684) has the molecular formula C22H50N6 and a molecular weight of 398.68 g/mol. Its IUPAC name is 1,4-dimethyl-7-propan-2-yl-1,4,7-triazonane.
| Compound Name | 1,4-dimethyl-7-propan-2-yl-1,4,7-triazonane |
|---|---|
| PubChem CID | 157390684 |
| Molecular Formula | C22H50N6 |
| Molecular Weight | 398.68 g/mol |
| Exact Mass | 398.41 |
| IUPAC Name | 1,4-dimethyl-7-propan-2-yl-1,4,7-triazonane |
| SMILES | CC(C)N1CCN(C)CCN(C)CC1.CC(C)N1CCN(C)CCN(C)CC1 |
| InChI | InChI=1S/2C11H25N3/c2*1-11(2)14-9-7-12(3)5-6-13(4)8-10-14/h2*11H,5-10H2,1-4H3 |
| InChIKey | BLYSMJFRGSPCJQ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 19.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.68 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |