About 1-methyl-7-propan-2-yl-1,4,7,10-tetrazacyclododecane
1-methyl-7-propan-2-yl-1,4,7,10-tetrazacyclododecane (PubChem CID 145053856) has the molecular formula C12H28N4
and a molecular weight of 228.38 g/mol. Its IUPAC name is 1-methyl-7-propan-2-yl-1,4,7,10-tetrazacyclododecane.
Molecular Properties
| Compound Name | 1-methyl-7-propan-2-yl-1,4,7,10-tetrazacyclododecane |
| PubChem CID | 145053856 |
| Molecular Formula | C12H28N4 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.23 |
| IUPAC Name | 1-methyl-7-propan-2-yl-1,4,7,10-tetrazacyclododecane |
| SMILES | CC(C)N1CCNCCN(C)CCNCC1 |
| InChI | InChI=1S/C12H28N4/c1-12(2)16-10-6-13-4-8-15(3)9-5-14-7-11-16/h12-14H,4-11H2,1-3H3 |
| InChIKey | MSLTYHBOVWAWOT-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methyl-7-propan-2-yl-1,4,7,10-tetrazacyclododecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-7-propan-2-yl-1,4,7,10-tetrazacyclododecane?
The IUPAC name of 1-methyl-7-propan-2-yl-1,4,7,10-tetrazacyclododecane (CID 145053856) is 1-methyl-7-propan-2-yl-1,4,7,10-tetrazacyclododecane.
What is the SMILES notation for 1-methyl-7-propan-2-yl-1,4,7,10-tetrazacyclododecane?
The canonical SMILES for 1-methyl-7-propan-2-yl-1,4,7,10-tetrazacyclododecane is CC(C)N1CCNCCN(C)CCNCC1.
What is the InChIKey of 1-methyl-7-propan-2-yl-1,4,7,10-tetrazacyclododecane?
The InChIKey is MSLTYHBOVWAWOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28N4/c1-12(2)16-10-6-13-4-8-15(3)9-5-14-7-11-16/h12-14H,4-11H2,1-3H3.
What are the key properties of 1-methyl-7-propan-2-yl-1,4,7,10-tetrazacyclododecane?
1-methyl-7-propan-2-yl-1,4,7,10-tetrazacyclododecane has a molecular weight of 228.38 g/mol, XLogP of -0.18, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-7-propan-2-yl-1,4,7,10-tetrazacyclododecane is sourced from PubChem (CID 145053856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).