About 1-propan-2-ylpiperazine;vanadium
1-propan-2-ylpiperazine;vanadium (PubChem CID 162375922) has the molecular formula C7H16N2V
and a molecular weight of 179.16 g/mol. Its IUPAC name is 1-propan-2-ylpiperazine;vanadium.
Molecular Properties
| Compound Name | 1-propan-2-ylpiperazine;vanadium |
| PubChem CID | 162375922 |
| Molecular Formula | C7H16N2V |
| Molecular Weight | 179.16 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 1-propan-2-ylpiperazine;vanadium |
| SMILES | CC(C)N1CCNCC1.[V] |
| InChI | InChI=1S/C7H16N2.V/c1-7(2)9-5-3-8-4-6-9;/h7-8H,3-6H2,1-2H3; |
| InChIKey | RLOXVMMQZZNMGA-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.16 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-propan-2-ylpiperazine;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-ylpiperazine;vanadium?
The IUPAC name of 1-propan-2-ylpiperazine;vanadium (CID 162375922) is 1-propan-2-ylpiperazine;vanadium.
What is the SMILES notation for 1-propan-2-ylpiperazine;vanadium?
The canonical SMILES for 1-propan-2-ylpiperazine;vanadium is CC(C)N1CCNCC1.[V].
What is the InChIKey of 1-propan-2-ylpiperazine;vanadium?
The InChIKey is RLOXVMMQZZNMGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2.V/c1-7(2)9-5-3-8-4-6-9;/h7-8H,3-6H2,1-2H3;.
What are the key properties of 1-propan-2-ylpiperazine;vanadium?
1-propan-2-ylpiperazine;vanadium has a molecular weight of 179.16 g/mol, XLogP of 0.30, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-ylpiperazine;vanadium is sourced from PubChem (CID 162375922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).