C11H20N2O4 — CID 70108433
(E)-but-2-enedioic acid;1-propan-2-ylpiperazine (PubChem CID 70108433) has the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;1-propan-2-ylpiperazine.
| Compound Name | (E)-but-2-enedioic acid;1-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 70108433 |
| Molecular Formula | C11H20N2O4 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | (E)-but-2-enedioic acid;1-propan-2-ylpiperazine |
| SMILES | CC(C)N1CCNCC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C7H16N2.C4H4O4/c1-7(2)9-5-3-8-4-6-9;5-3(6)1-2-4(7)8/h7-8H,3-6H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | FQWRFRRKXBPMLR-WLHGVMLRSA-N |
| XLogP | 0.01 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|