About (Z)-but-2-enedioic acid;1-ethylpiperazine
(Z)-but-2-enedioic acid;1-ethylpiperazine (PubChem CID 175604137) has the molecular formula C10H18N2O4
and a molecular weight of 230.26 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;1-ethylpiperazine.
Molecular Properties
| Compound Name | (Z)-but-2-enedioic acid;1-ethylpiperazine |
| PubChem CID | 175604137 |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (Z)-but-2-enedioic acid;1-ethylpiperazine |
| SMILES | CCN1CCNCC1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C6H14N2.C4H4O4/c1-2-8-5-3-7-4-6-8;5-3(6)1-2-4(7)8/h7H,2-6H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | FQVHRFVEJHFROF-BTJKTKAUSA-N |
| XLogP | -0.38 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-enedioic acid;1-ethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-enedioic acid;1-ethylpiperazine?
The IUPAC name of (Z)-but-2-enedioic acid;1-ethylpiperazine (CID 175604137) is (Z)-but-2-enedioic acid;1-ethylpiperazine.
What is the SMILES notation for (Z)-but-2-enedioic acid;1-ethylpiperazine?
The canonical SMILES for (Z)-but-2-enedioic acid;1-ethylpiperazine is CCN1CCNCC1.O=C(O)/C=C\C(=O)O.
What is the InChIKey of (Z)-but-2-enedioic acid;1-ethylpiperazine?
The InChIKey is FQVHRFVEJHFROF-BTJKTKAUSA-N. The full InChI is InChI=1S/C6H14N2.C4H4O4/c1-2-8-5-3-7-4-6-8;5-3(6)1-2-4(7)8/h7H,2-6H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1-.
What are the key properties of (Z)-but-2-enedioic acid;1-ethylpiperazine?
(Z)-but-2-enedioic acid;1-ethylpiperazine has a molecular weight of 230.26 g/mol, XLogP of -0.38, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-enedioic acid;1-ethylpiperazine is sourced from PubChem (CID 175604137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).