C17H37N3O — CID 166458931
1,4-dimethylpiperazine;2-methylpropanal;1-propan-2-ylpyrrolidine (PubChem CID 166458931) has the molecular formula C17H37N3O and a molecular weight of 299.50 g/mol. Its IUPAC name is 1,4-dimethylpiperazine;2-methylpropanal;1-propan-2-ylpyrrolidine.
| Compound Name | 1,4-dimethylpiperazine;2-methylpropanal;1-propan-2-ylpyrrolidine |
|---|---|
| PubChem CID | 166458931 |
| Molecular Formula | C17H37N3O |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.29 |
| IUPAC Name | 1,4-dimethylpiperazine;2-methylpropanal;1-propan-2-ylpyrrolidine |
| SMILES | CC(C)C=O.CC(C)N1CCCC1.CN1CCN(C)CC1 |
| InChI | InChI=1S/C7H15N.C6H14N2.C4H8O/c1-7(2)8-5-3-4-6-8;1-7-3-5-8(2)6-4-7;1-4(2)3-5/h7H,3-6H2,1-2H3;3-6H2,1-2H3;3-4H,1-2H3 |
| InChIKey | OAXXPNBAVYBPCF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|