C15H33NO — CID 177325455
2,2-dimethylpropanal;ethane;1-propan-2-ylpiperidine (PubChem CID 177325455) has the molecular formula C15H33NO and a molecular weight of 243.43 g/mol. Its IUPAC name is 2,2-dimethylpropanal;ethane;1-propan-2-ylpiperidine.
| Compound Name | 2,2-dimethylpropanal;ethane;1-propan-2-ylpiperidine |
|---|---|
| PubChem CID | 177325455 |
| Molecular Formula | C15H33NO |
| Molecular Weight | 243.43 g/mol |
| Exact Mass | 243.26 |
| IUPAC Name | 2,2-dimethylpropanal;ethane;1-propan-2-ylpiperidine |
| SMILES | CC.CC(C)(C)C=O.CC(C)N1CCCCC1 |
| InChI | InChI=1S/C8H17N.C5H10O.C2H6/c1-8(2)9-6-4-3-5-7-9;1-5(2,3)4-6;1-2/h8H,3-7H2,1-2H3;4H,1-3H3;1-2H3 |
| InChIKey | FFRVLMWRANFLCY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.43 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|