About methoxymethane;1-propan-2-ylpiperidine
methoxymethane;1-propan-2-ylpiperidine (PubChem CID 153352735) has the molecular formula C10H23NO
and a molecular weight of 173.30 g/mol. Its IUPAC name is methoxymethane;1-propan-2-ylpiperidine.
Molecular Properties
| Compound Name | methoxymethane;1-propan-2-ylpiperidine |
| PubChem CID | 153352735 |
| Molecular Formula | C10H23NO |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.18 |
| IUPAC Name | methoxymethane;1-propan-2-ylpiperidine |
| SMILES | CC(C)N1CCCCC1.COC |
| InChI | InChI=1S/C8H17N.C2H6O/c1-8(2)9-6-4-3-5-7-9;1-3-2/h8H,3-7H2,1-2H3;1-2H3 |
| InChIKey | BVPWNPIYYZUWAX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methoxymethane;1-propan-2-ylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxymethane;1-propan-2-ylpiperidine?
The IUPAC name of methoxymethane;1-propan-2-ylpiperidine (CID 153352735) is methoxymethane;1-propan-2-ylpiperidine.
What is the SMILES notation for methoxymethane;1-propan-2-ylpiperidine?
The canonical SMILES for methoxymethane;1-propan-2-ylpiperidine is CC(C)N1CCCCC1.COC.
What is the InChIKey of methoxymethane;1-propan-2-ylpiperidine?
The InChIKey is BVPWNPIYYZUWAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N.C2H6O/c1-8(2)9-6-4-3-5-7-9;1-3-2/h8H,3-7H2,1-2H3;1-2H3.
What are the key properties of methoxymethane;1-propan-2-ylpiperidine?
methoxymethane;1-propan-2-ylpiperidine has a molecular weight of 173.30 g/mol, XLogP of 2.14, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methoxymethane;1-propan-2-ylpiperidine is sourced from PubChem (CID 153352735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).