About 1-propan-2-ylpiperidine;hydrobromide
1-propan-2-ylpiperidine;hydrobromide (PubChem CID 44887258) has the molecular formula C8H18BrN
and a molecular weight of 208.14 g/mol. Its IUPAC name is 1-propan-2-ylpiperidine;hydrobromide.
Molecular Properties
| Compound Name | 1-propan-2-ylpiperidine;hydrobromide |
| PubChem CID | 44887258 |
| Molecular Formula | C8H18BrN |
| Molecular Weight | 208.14 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 1-propan-2-ylpiperidine;hydrobromide |
| SMILES | Br.CC(C)N1CCCCC1 |
| InChI | InChI=1S/C8H17N.BrH/c1-8(2)9-6-4-3-5-7-9;/h8H,3-7H2,1-2H3;1H |
| InChIKey | PVNQEYFZHDPTNJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.14 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-propan-2-ylpiperidine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-ylpiperidine;hydrobromide?
The IUPAC name of 1-propan-2-ylpiperidine;hydrobromide (CID 44887258) is 1-propan-2-ylpiperidine;hydrobromide.
What is the SMILES notation for 1-propan-2-ylpiperidine;hydrobromide?
The canonical SMILES for 1-propan-2-ylpiperidine;hydrobromide is Br.CC(C)N1CCCCC1.
What is the InChIKey of 1-propan-2-ylpiperidine;hydrobromide?
The InChIKey is PVNQEYFZHDPTNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N.BrH/c1-8(2)9-6-4-3-5-7-9;/h8H,3-7H2,1-2H3;1H.
What are the key properties of 1-propan-2-ylpiperidine;hydrobromide?
1-propan-2-ylpiperidine;hydrobromide has a molecular weight of 208.14 g/mol, XLogP of 2.46, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-ylpiperidine;hydrobromide is sourced from PubChem (CID 44887258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).