About ethane;1-propan-2-ylpiperidine;1-propan-2-ylpyrrolidine
ethane;1-propan-2-ylpiperidine;1-propan-2-ylpyrrolidine (PubChem CID 177140338) has the molecular formula C17H38N2
and a molecular weight of 270.50 g/mol. Its IUPAC name is ethane;1-propan-2-ylpiperidine;1-propan-2-ylpyrrolidine.
Molecular Properties
| Compound Name | ethane;1-propan-2-ylpiperidine;1-propan-2-ylpyrrolidine |
| PubChem CID | 177140338 |
| Molecular Formula | C17H38N2 |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 270.30 |
| IUPAC Name | ethane;1-propan-2-ylpiperidine;1-propan-2-ylpyrrolidine |
| SMILES | CC.CC(C)N1CCCC1.CC(C)N1CCCCC1 |
| InChI | InChI=1S/C8H17N.C7H15N.C2H6/c1-8(2)9-6-4-3-5-7-9;1-7(2)8-5-3-4-6-8;1-2/h8H,3-7H2,1-2H3;7H,3-6H2,1-2H3;1-2H3 |
| InChIKey | YBHWDSTUPZFFIW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;1-propan-2-ylpiperidine;1-propan-2-ylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-propan-2-ylpiperidine;1-propan-2-ylpyrrolidine?
The IUPAC name of ethane;1-propan-2-ylpiperidine;1-propan-2-ylpyrrolidine (CID 177140338) is ethane;1-propan-2-ylpiperidine;1-propan-2-ylpyrrolidine.
What is the SMILES notation for ethane;1-propan-2-ylpiperidine;1-propan-2-ylpyrrolidine?
The canonical SMILES for ethane;1-propan-2-ylpiperidine;1-propan-2-ylpyrrolidine is CC.CC(C)N1CCCC1.CC(C)N1CCCCC1.
What is the InChIKey of ethane;1-propan-2-ylpiperidine;1-propan-2-ylpyrrolidine?
The InChIKey is YBHWDSTUPZFFIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N.C7H15N.C2H6/c1-8(2)9-6-4-3-5-7-9;1-7(2)8-5-3-4-6-8;1-2/h8H,3-7H2,1-2H3;7H,3-6H2,1-2H3;1-2H3.
What are the key properties of ethane;1-propan-2-ylpiperidine;1-propan-2-ylpyrrolidine?
ethane;1-propan-2-ylpiperidine;1-propan-2-ylpyrrolidine has a molecular weight of 270.50 g/mol, XLogP of 4.40, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-propan-2-ylpiperidine;1-propan-2-ylpyrrolidine is sourced from PubChem (CID 177140338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).