C13H28N2O — CID 176969911
1-methylpiperidine;4-propan-2-ylmorpholine (PubChem CID 176969911) has the molecular formula C13H28N2O and a molecular weight of 228.38 g/mol. Its IUPAC name is 1-methylpiperidine;4-propan-2-ylmorpholine.
| Compound Name | 1-methylpiperidine;4-propan-2-ylmorpholine |
|---|---|
| PubChem CID | 176969911 |
| Molecular Formula | C13H28N2O |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.22 |
| IUPAC Name | 1-methylpiperidine;4-propan-2-ylmorpholine |
| SMILES | CC(C)N1CCOCC1.CN1CCCCC1 |
| InChI | InChI=1S/C7H15NO.C6H13N/c1-7(2)8-3-5-9-6-4-8;1-7-5-3-2-4-6-7/h7H,3-6H2,1-2H3;2-6H2,1H3 |
| InChIKey | PCBUYMPKHXVOTD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |