About fluoromethane;4-propan-2-ylmorpholine
fluoromethane;4-propan-2-ylmorpholine (PubChem CID 177187231) has the molecular formula C8H18FNO
and a molecular weight of 163.24 g/mol. Its IUPAC name is fluoromethane;4-propan-2-ylmorpholine.
Molecular Properties
| Compound Name | fluoromethane;4-propan-2-ylmorpholine |
| PubChem CID | 177187231 |
| Molecular Formula | C8H18FNO |
| Molecular Weight | 163.24 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | fluoromethane;4-propan-2-ylmorpholine |
| SMILES | CC(C)N1CCOCC1.CF |
| InChI | InChI=1S/C7H15NO.CH3F/c1-7(2)8-3-5-9-6-4-8;1-2/h7H,3-6H2,1-2H3;1H3 |
| InChIKey | VKUVKDLUEWJMRY-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze fluoromethane;4-propan-2-ylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoromethane;4-propan-2-ylmorpholine?
The IUPAC name of fluoromethane;4-propan-2-ylmorpholine (CID 177187231) is fluoromethane;4-propan-2-ylmorpholine.
What is the SMILES notation for fluoromethane;4-propan-2-ylmorpholine?
The canonical SMILES for fluoromethane;4-propan-2-ylmorpholine is CC(C)N1CCOCC1.CF.
What is the InChIKey of fluoromethane;4-propan-2-ylmorpholine?
The InChIKey is VKUVKDLUEWJMRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO.CH3F/c1-7(2)8-3-5-9-6-4-8;1-2/h7H,3-6H2,1-2H3;1H3.
What are the key properties of fluoromethane;4-propan-2-ylmorpholine?
fluoromethane;4-propan-2-ylmorpholine has a molecular weight of 163.24 g/mol, XLogP of 1.31, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for fluoromethane;4-propan-2-ylmorpholine is sourced from PubChem (CID 177187231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).