C8H17FN2 — CID 155701545
1-fluoro-4-propan-2-yl-1,4-diazepane (PubChem CID 155701545) has the molecular formula C8H17FN2 and a molecular weight of 160.24 g/mol. Its IUPAC name is 1-fluoro-4-propan-2-yl-1,4-diazepane.
| Compound Name | 1-fluoro-4-propan-2-yl-1,4-diazepane |
|---|---|
| PubChem CID | 155701545 |
| Molecular Formula | C8H17FN2 |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.14 |
| IUPAC Name | 1-fluoro-4-propan-2-yl-1,4-diazepane |
| SMILES | CC(C)N1CCCN(F)CC1 |
| InChI | InChI=1S/C8H17FN2/c1-8(2)10-4-3-5-11(9)7-6-10/h8H,3-7H2,1-2H3 |
| InChIKey | XTESOOQZCZJAAP-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|