C13H28N2 — CID 168909794
1-pentan-3-yl-4-propan-2-yl-1,4-diazepane (PubChem CID 168909794) has the molecular formula C13H28N2 and a molecular weight of 212.38 g/mol. Its IUPAC name is 1-pentan-3-yl-4-propan-2-yl-1,4-diazepane.
| Compound Name | 1-pentan-3-yl-4-propan-2-yl-1,4-diazepane |
|---|---|
| PubChem CID | 168909794 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | 1-pentan-3-yl-4-propan-2-yl-1,4-diazepane |
| SMILES | CCC(CC)N1CCCN(C(C)C)CC1 |
| InChI | InChI=1S/C13H28N2/c1-5-13(6-2)15-9-7-8-14(10-11-15)12(3)4/h12-13H,5-11H2,1-4H3 |
| InChIKey | XROIMZJDRUNDGR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |