C11H24N2O — CID 142366047
N,N-diethylformamide;1-propan-2-ylazetidine (PubChem CID 142366047) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is N,N-diethylformamide;1-propan-2-ylazetidine.
| Compound Name | N,N-diethylformamide;1-propan-2-ylazetidine |
|---|---|
| PubChem CID | 142366047 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | N,N-diethylformamide;1-propan-2-ylazetidine |
| SMILES | CC(C)N1CCC1.CCN(C=O)CC |
| InChI | InChI=1S/C6H13N.C5H11NO/c1-6(2)7-4-3-5-7;1-3-6(4-2)5-7/h6H,3-5H2,1-2H3;5H,3-4H2,1-2H3 |
| InChIKey | ZTIDNCJZVVGGBQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|