About N-(2-methoxyethyl)-N-methylformamide;1-propan-2-ylazetidine
N-(2-methoxyethyl)-N-methylformamide;1-propan-2-ylazetidine (PubChem CID 168941075) has the molecular formula C11H24N2O2
and a molecular weight of 216.32 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N-methylformamide;1-propan-2-ylazetidine.
Molecular Properties
| Compound Name | N-(2-methoxyethyl)-N-methylformamide;1-propan-2-ylazetidine |
| PubChem CID | 168941075 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | N-(2-methoxyethyl)-N-methylformamide;1-propan-2-ylazetidine |
| SMILES | CC(C)N1CCC1.COCCN(C)C=O |
| InChI | InChI=1S/C6H13N.C5H11NO2/c1-6(2)7-4-3-5-7;1-6(5-7)3-4-8-2/h6H,3-5H2,1-2H3;5H,3-4H2,1-2H3 |
| InChIKey | LDAJJJQWALAYLY-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methoxyethyl)-N-methylformamide;1-propan-2-ylazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methoxyethyl)-N-methylformamide;1-propan-2-ylazetidine?
The IUPAC name of N-(2-methoxyethyl)-N-methylformamide;1-propan-2-ylazetidine (CID 168941075) is N-(2-methoxyethyl)-N-methylformamide;1-propan-2-ylazetidine.
What is the SMILES notation for N-(2-methoxyethyl)-N-methylformamide;1-propan-2-ylazetidine?
The canonical SMILES for N-(2-methoxyethyl)-N-methylformamide;1-propan-2-ylazetidine is CC(C)N1CCC1.COCCN(C)C=O.
What is the InChIKey of N-(2-methoxyethyl)-N-methylformamide;1-propan-2-ylazetidine?
The InChIKey is LDAJJJQWALAYLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N.C5H11NO2/c1-6(2)7-4-3-5-7;1-6(5-7)3-4-8-2/h6H,3-5H2,1-2H3;5H,3-4H2,1-2H3.
What are the key properties of N-(2-methoxyethyl)-N-methylformamide;1-propan-2-ylazetidine?
N-(2-methoxyethyl)-N-methylformamide;1-propan-2-ylazetidine has a molecular weight of 216.32 g/mol, XLogP of 0.82, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methoxyethyl)-N-methylformamide;1-propan-2-ylazetidine is sourced from PubChem (CID 168941075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).