C9H18N2O — CID 87764611
4-propan-2-yl-1,4-diazepane-1-carbaldehyde (PubChem CID 87764611) has the molecular formula C9H18N2O and a molecular weight of 170.26 g/mol. Its IUPAC name is 4-propan-2-yl-1,4-diazepane-1-carbaldehyde.
| Compound Name | 4-propan-2-yl-1,4-diazepane-1-carbaldehyde |
|---|---|
| PubChem CID | 87764611 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | 4-propan-2-yl-1,4-diazepane-1-carbaldehyde |
| SMILES | CC(C)N1CCCN(C=O)CC1 |
| InChI | InChI=1S/C9H18N2O/c1-9(2)11-5-3-4-10(8-12)6-7-11/h8-9H,3-7H2,1-2H3 |
| InChIKey | XESKTJJMJJEXDV-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|