C13H28GaN — CID 173385251
1-pentan-3-yl-1,6-azagallecane (PubChem CID 173385251) has the molecular formula C13H28GaN and a molecular weight of 268.10 g/mol. Its IUPAC name is 1-pentan-3-yl-1,6-azagallecane.
| Compound Name | 1-pentan-3-yl-1,6-azagallecane |
|---|---|
| PubChem CID | 173385251 |
| Molecular Formula | C13H28GaN |
| Molecular Weight | 268.10 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 1-pentan-3-yl-1,6-azagallecane |
| SMILES | CCC(CC)N1CCCC[GaH]CCCC1 |
| InChI | InChI=1S/C13H27N.Ga.H/c1-5-9-11-14(12-10-6-2)13(7-3)8-4;;/h13H,1-2,5-12H2,3-4H3;; |
| InChIKey | YURHSESSUACFMC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.10 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |