About propan-2-one;6-propan-2-yl-6-azaspiro[2.5]octane
propan-2-one;6-propan-2-yl-6-azaspiro[2.5]octane (PubChem CID 170791695) has the molecular formula C13H25NO
and a molecular weight of 211.35 g/mol. Its IUPAC name is propan-2-one;6-propan-2-yl-6-azaspiro[2.5]octane.
Molecular Properties
| Compound Name | propan-2-one;6-propan-2-yl-6-azaspiro[2.5]octane |
| PubChem CID | 170791695 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | propan-2-one;6-propan-2-yl-6-azaspiro[2.5]octane |
| SMILES | CC(C)=O.CC(C)N1CCC2(CC1)CC2 |
| InChI | InChI=1S/C10H19N.C3H6O/c1-9(2)11-7-5-10(3-4-10)6-8-11;1-3(2)4/h9H,3-8H2,1-2H3;1-2H3 |
| InChIKey | ZITAXKKXZFKJDF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propan-2-one;6-propan-2-yl-6-azaspiro[2.5]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-one;6-propan-2-yl-6-azaspiro[2.5]octane?
The IUPAC name of propan-2-one;6-propan-2-yl-6-azaspiro[2.5]octane (CID 170791695) is propan-2-one;6-propan-2-yl-6-azaspiro[2.5]octane.
What is the SMILES notation for propan-2-one;6-propan-2-yl-6-azaspiro[2.5]octane?
The canonical SMILES for propan-2-one;6-propan-2-yl-6-azaspiro[2.5]octane is CC(C)=O.CC(C)N1CCC2(CC1)CC2.
What is the InChIKey of propan-2-one;6-propan-2-yl-6-azaspiro[2.5]octane?
The InChIKey is ZITAXKKXZFKJDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N.C3H6O/c1-9(2)11-7-5-10(3-4-10)6-8-11;1-3(2)4/h9H,3-8H2,1-2H3;1-2H3.
What are the key properties of propan-2-one;6-propan-2-yl-6-azaspiro[2.5]octane?
propan-2-one;6-propan-2-yl-6-azaspiro[2.5]octane has a molecular weight of 211.35 g/mol, XLogP of 2.87, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-one;6-propan-2-yl-6-azaspiro[2.5]octane is sourced from PubChem (CID 170791695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).