C18H37N — CID 154680928
3,9-di(propan-2-yl)-3-azaspiro[5.5]undecane;ethane (PubChem CID 154680928) has the molecular formula C18H37N and a molecular weight of 267.50 g/mol. Its IUPAC name is 3,9-di(propan-2-yl)-3-azaspiro[5.5]undecane;ethane.
| Compound Name | 3,9-di(propan-2-yl)-3-azaspiro[5.5]undecane;ethane |
|---|---|
| PubChem CID | 154680928 |
| Molecular Formula | C18H37N |
| Molecular Weight | 267.50 g/mol |
| Exact Mass | 267.29 |
| IUPAC Name | 3,9-di(propan-2-yl)-3-azaspiro[5.5]undecane;ethane |
| SMILES | CC.CC(C)C1CCC2(CC1)CCN(C(C)C)CC2 |
| InChI | InChI=1S/C16H31N.C2H6/c1-13(2)15-5-7-16(8-6-15)9-11-17(12-10-16)14(3)4;1-2/h13-15H,5-12H2,1-4H3;1-2H3 |
| InChIKey | DWNMFIRWAHUPNK-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.50 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |