C13H25N — CID 167272832
(6R)-2,6-di(propan-2-yl)-2-azaspiro[3.4]octane (PubChem CID 167272832) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is (6R)-2,6-di(propan-2-yl)-2-azaspiro[3.4]octane.
| Compound Name | (6R)-2,6-di(propan-2-yl)-2-azaspiro[3.4]octane |
|---|---|
| PubChem CID | 167272832 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | (6R)-2,6-di(propan-2-yl)-2-azaspiro[3.4]octane |
| SMILES | CC(C)[C@@H]1CCC2(C1)CN(C(C)C)C2 |
| InChI | InChI=1S/C13H25N/c1-10(2)12-5-6-13(7-12)8-14(9-13)11(3)4/h10-12H,5-9H2,1-4H3/t12-/m1/s1 |
| InChIKey | OSMYMHNRVUVCPZ-GFCCVEGCSA-N |
| XLogP | 3.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |