C8H18N2O — CID 70607073
1-(1,4-diazepan-1-yl)propan-1-ol (PubChem CID 70607073) has the molecular formula C8H18N2O and a molecular weight of 158.24 g/mol. Its IUPAC name is 1-(1,4-diazepan-1-yl)propan-1-ol.
| Compound Name | 1-(1,4-diazepan-1-yl)propan-1-ol |
|---|---|
| PubChem CID | 70607073 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | 1-(1,4-diazepan-1-yl)propan-1-ol |
| SMILES | CCC(O)N1CCCNCC1 |
| InChI | InChI=1S/C8H18N2O/c1-2-8(11)10-6-3-4-9-5-7-10/h8-9,11H,2-7H2,1H3 |
| InChIKey | MGHNKFVKOVRYHG-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |