C13H21N3 — CID 3349010
1-(1-pyridin-4-ylpropyl)-1,4-diazepane (PubChem CID 3349010) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 1-(1-pyridin-4-ylpropyl)-1,4-diazepane.
| Compound Name | 1-(1-pyridin-4-ylpropyl)-1,4-diazepane |
|---|---|
| PubChem CID | 3349010 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 1-(1-pyridin-4-ylpropyl)-1,4-diazepane |
| SMILES | CCC(c1ccncc1)N1CCCNCC1 |
| InChI | InChI=1S/C13H21N3/c1-2-13(12-4-7-15-8-5-12)16-10-3-6-14-9-11-16/h4-5,7-8,13-14H,2-3,6,9-11H2,1H3 |
| InChIKey | JUBWHPXWKCKYSX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |