C10H22N2S — CID 124594878
1-[(2S)-1-ethylsulfanylpropan-2-yl]-1,4-diazepane (PubChem CID 124594878) has the molecular formula C10H22N2S and a molecular weight of 202.37 g/mol. Its IUPAC name is 1-[(2S)-1-ethylsulfanylpropan-2-yl]-1,4-diazepane.
| Compound Name | 1-[(2S)-1-ethylsulfanylpropan-2-yl]-1,4-diazepane |
|---|---|
| PubChem CID | 124594878 |
| Molecular Formula | C10H22N2S |
| Molecular Weight | 202.37 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 1-[(2S)-1-ethylsulfanylpropan-2-yl]-1,4-diazepane |
| SMILES | CCSC[C@H](C)N1CCCNCC1 |
| InChI | InChI=1S/C10H22N2S/c1-3-13-9-10(2)12-7-4-5-11-6-8-12/h10-11H,3-9H2,1-2H3/t10-/m0/s1 |
| InChIKey | YELSOHRDLDBEHU-JTQLQIEISA-N |
| XLogP | 1.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |