C10H17F3N2O2 — CID 90829528
2-(1,4-diazepan-1-yl)propyl 2,2,2-trifluoroacetate (PubChem CID 90829528) has the molecular formula C10H17F3N2O2 and a molecular weight of 254.25 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)propyl 2,2,2-trifluoroacetate.
| Compound Name | 2-(1,4-diazepan-1-yl)propyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 90829528 |
| Molecular Formula | C10H17F3N2O2 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)propyl 2,2,2-trifluoroacetate |
| SMILES | CC(COC(=O)C(F)(F)F)N1CCCNCC1 |
| InChI | InChI=1S/C10H17F3N2O2/c1-8(7-17-9(16)10(11,12)13)15-5-2-3-14-4-6-15/h8,14H,2-7H2,1H3 |
| InChIKey | METXFCJHWMLTFM-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |