About methyl 2-(1,4-diazepan-1-yl)-3-hydroxypropanoate
methyl 2-(1,4-diazepan-1-yl)-3-hydroxypropanoate (PubChem CID 104711236) has the molecular formula C9H18N2O3
and a molecular weight of 202.25 g/mol. Its IUPAC name is methyl 2-(1,4-diazepan-1-yl)-3-hydroxypropanoate.
Molecular Properties
| Compound Name | methyl 2-(1,4-diazepan-1-yl)-3-hydroxypropanoate |
| PubChem CID | 104711236 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | methyl 2-(1,4-diazepan-1-yl)-3-hydroxypropanoate |
| SMILES | COC(=O)C(CO)N1CCCNCC1 |
| InChI | InChI=1S/C9H18N2O3/c1-14-9(13)8(7-12)11-5-2-3-10-4-6-11/h8,10,12H,2-7H2,1H3 |
| InChIKey | FPJIFUGVNPEBBU-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-(1,4-diazepan-1-yl)-3-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(1,4-diazepan-1-yl)-3-hydroxypropanoate?
The IUPAC name of methyl 2-(1,4-diazepan-1-yl)-3-hydroxypropanoate (CID 104711236) is methyl 2-(1,4-diazepan-1-yl)-3-hydroxypropanoate.
What is the SMILES notation for methyl 2-(1,4-diazepan-1-yl)-3-hydroxypropanoate?
The canonical SMILES for methyl 2-(1,4-diazepan-1-yl)-3-hydroxypropanoate is COC(=O)C(CO)N1CCCNCC1.
What is the InChIKey of methyl 2-(1,4-diazepan-1-yl)-3-hydroxypropanoate?
The InChIKey is FPJIFUGVNPEBBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O3/c1-14-9(13)8(7-12)11-5-2-3-10-4-6-11/h8,10,12H,2-7H2,1H3.
What are the key properties of methyl 2-(1,4-diazepan-1-yl)-3-hydroxypropanoate?
methyl 2-(1,4-diazepan-1-yl)-3-hydroxypropanoate has a molecular weight of 202.25 g/mol, XLogP of -1.18, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(1,4-diazepan-1-yl)-3-hydroxypropanoate is sourced from PubChem (CID 104711236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).